C29H32N2O4 — CID 133214204
2-[benzyl-(2-phenoxyacetyl)amino]-N-(oxolan-2-ylmethyl)-3-phenylpropanamide (PubChem CID 133214204) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[benzyl-(2-phenoxyacetyl)amino]-N-(oxolan-2-ylmethyl)-3-phenylpropanamide.
| Compound Name | 2-[benzyl-(2-phenoxyacetyl)amino]-N-(oxolan-2-ylmethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214204 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[benzyl-(2-phenoxyacetyl)amino]-N-(oxolan-2-ylmethyl)-3-phenylpropanamide |
| SMILES | O=C(NCC1CCCO1)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C29H32N2O4/c32-28(22-35-25-15-8-3-9-16-25)31(21-24-13-6-2-7-14-24)27(19-23-11-4-1-5-12-23)29(33)30-20-26-17-10-18-34-26/h1-9,11-16,26-27H,10,17-22H2,(H,30,33) |
| InChIKey | BEUQAGIBUHLBRL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |