C32H36N2O3 — CID 133214188
2-[benzyl-(2-phenoxyacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide (PubChem CID 133214188) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[benzyl-(2-phenoxyacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[benzyl-(2-phenoxyacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214188 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2-[benzyl-(2-phenoxyacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
| SMILES | O=C(NCCC1=CCCCC1)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)COc1ccccc1 |
| InChI | InChI=1S/C32H36N2O3/c35-31(25-37-29-19-11-4-12-20-29)34(24-28-17-9-3-10-18-28)30(23-27-15-7-2-8-16-27)32(36)33-22-21-26-13-5-1-6-14-26/h2-4,7-13,15-20,30H,1,5-6,14,21-25H2,(H,33,36) |
| InChIKey | XCXLVGSNEPDDPT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|