C31H33ClN2O3 — CID 133236897
2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylacetamide (PubChem CID 133236897) has the molecular formula C31H33ClN2O3 and a molecular weight of 517.07 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylacetamide.
| Compound Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 133236897 |
| Molecular Formula | C31H33ClN2O3 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-2-phenylacetamide |
| SMILES | O=C(NCCC1=CCCCC1)C(c1ccccc1)N(Cc1ccccc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C31H33ClN2O3/c32-27-18-10-11-19-28(27)37-23-29(35)34(22-25-14-6-2-7-15-25)30(26-16-8-3-9-17-26)31(36)33-21-20-24-12-4-1-5-13-24/h2-3,6-12,14-19,30H,1,4-5,13,20-23H2,(H,33,36) |
| InChIKey | IKLOVTWDNCNRHN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|