C26H25ClN2O3 — CID 133236895
2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-2-phenyl-N-prop-2-enylacetamide (PubChem CID 133236895) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-2-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-2-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 133236895 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-2-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(c1ccccc1)N(Cc1ccccc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C26H25ClN2O3/c1-2-17-28-26(31)25(21-13-7-4-8-14-21)29(18-20-11-5-3-6-12-20)24(30)19-32-23-16-10-9-15-22(23)27/h2-16,25H,1,17-19H2,(H,28,31) |
| InChIKey | XIYYBRYPVIMBKH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|