C27H27ClN2O3 — CID 133213876
2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide (PubChem CID 133213876) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide.
| Compound Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 133213876 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-3-phenyl-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C27H27ClN2O3/c1-2-17-29-27(32)24(18-21-11-5-3-6-12-21)30(19-22-13-7-4-8-14-22)26(31)20-33-25-16-10-9-15-23(25)28/h2-16,24H,1,17-20H2,(H,29,32) |
| InChIKey | WUHAPYKPHCKARR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|