C27H27ClN2O4 — CID 133238462
2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-prop-2-enylacetamide (PubChem CID 133238462) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 133238462 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C(c1ccccc1)N(Cc1ccc(OC)cc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C27H27ClN2O4/c1-3-17-29-27(32)26(21-9-5-4-6-10-21)30(18-20-13-15-22(33-2)16-14-20)25(31)19-34-24-12-8-7-11-23(24)28/h3-16,26H,1,17-19H2,2H3,(H,29,32) |
| InChIKey | IOLMUKABYLGYCX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|