C27H29ClN2O5 — CID 133238532
2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide (PubChem CID 133238532) has the molecular formula C27H29ClN2O5 and a molecular weight of 496.99 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide.
| Compound Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 133238532 |
| Molecular Formula | C27H29ClN2O5 |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(4-methoxyphenyl)methyl]amino]-N-(2-methoxyethyl)-2-phenylacetamide |
| SMILES | COCCNC(=O)C(c1ccccc1)N(Cc1ccc(OC)cc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C27H29ClN2O5/c1-33-17-16-29-27(32)26(21-8-4-3-5-9-21)30(18-20-12-14-22(34-2)15-13-20)25(31)19-35-24-11-7-6-10-23(24)28/h3-15,26H,16-19H2,1-2H3,(H,29,32) |
| InChIKey | HYWRHWCQQCIIAX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|