C27H29ClN2O4 — CID 133213879
2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-3-phenylpropanamide (PubChem CID 133213879) has the molecular formula C27H29ClN2O4 and a molecular weight of 480.99 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133213879 |
| Molecular Formula | C27H29ClN2O4 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-(2-methoxyethyl)-3-phenylpropanamide |
| SMILES | COCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C27H29ClN2O4/c1-33-17-16-29-27(32)24(18-21-10-4-2-5-11-21)30(19-22-12-6-3-7-13-22)26(31)20-34-25-15-9-8-14-23(25)28/h2-15,24H,16-20H2,1H3,(H,29,32) |
| InChIKey | VUNOVDMOAZTBTD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|