C28H29Cl3N2O3 — CID 133204390
N-butyl-2-[[2-(2-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133204390) has the molecular formula C28H29Cl3N2O3 and a molecular weight of 547.91 g/mol. Its IUPAC name is N-butyl-2-[[2-(2-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(2-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133204390 |
| Molecular Formula | C28H29Cl3N2O3 |
| Molecular Weight | 547.91 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | N-butyl-2-[[2-(2-chlorophenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C28H29Cl3N2O3/c1-2-3-16-32-28(35)25(17-20-10-5-4-6-11-20)33(18-21-22(29)13-9-14-23(21)30)27(34)19-36-26-15-8-7-12-24(26)31/h4-15,25H,2-3,16-19H2,1H3,(H,32,35) |
| InChIKey | BPWZTEDJAHATNF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.91 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|