C28H29Cl2FN2O3 — CID 100705947
(2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100705947) has the molecular formula C28H29Cl2FN2O3 and a molecular weight of 531.46 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100705947 |
| Molecular Formula | C28H29Cl2FN2O3 |
| Molecular Weight | 531.46 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(4-fluorophenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C28H29Cl2FN2O3/c1-2-3-16-32-28(35)26(17-20-8-5-4-6-9-20)33(18-23-24(29)10-7-11-25(23)30)27(34)19-36-22-14-12-21(31)13-15-22/h4-15,26H,2-3,16-19H2,1H3,(H,32,35)/t26-/m0/s1 |
| InChIKey | BWNMDTPJTYZADM-SANMLTNESA-N |
| XLogP | 6.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|