C28H30ClFN2O3 — CID 133232392
N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133232392) has the molecular formula C28H30ClFN2O3 and a molecular weight of 497.01 g/mol. Its IUPAC name is N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133232392 |
| Molecular Formula | C28H30ClFN2O3 |
| Molecular Weight | 497.01 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-butyl-2-[[2-(3-chlorophenoxy)acetyl]-[(4-fluorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C28H30ClFN2O3/c1-2-3-16-31-28(34)26(17-21-8-5-4-6-9-21)32(19-22-12-14-24(30)15-13-22)27(33)20-35-25-11-7-10-23(29)18-25/h4-15,18,26H,2-3,16-17,19-20H2,1H3,(H,31,34) |
| InChIKey | JLFJIZLRNRYUNB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.01 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|