C32H38Cl2N2O3 — CID 100704101
(2S)-N-butyl-2-[[2-(4-tert-butylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100704101) has the molecular formula C32H38Cl2N2O3 and a molecular weight of 569.57 g/mol. Its IUPAC name is (2S)-N-butyl-2-[[2-(4-tert-butylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[[2-(4-tert-butylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100704101 |
| Molecular Formula | C32H38Cl2N2O3 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2S)-N-butyl-2-[[2-(4-tert-butylphenoxy)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)COc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H38Cl2N2O3/c1-5-6-19-35-31(38)29(20-23-11-8-7-9-12-23)36(21-26-27(33)13-10-14-28(26)34)30(37)22-39-25-17-15-24(16-18-25)32(2,3)4/h7-18,29H,5-6,19-22H2,1-4H3,(H,35,38)/t29-/m0/s1 |
| InChIKey | RBQVRPLZIMIUGH-LJAQVGFWSA-N |
| XLogP | 7.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|