C26H31ClN2O3 — CID 133148738
2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 133148738) has the molecular formula C26H31ClN2O3 and a molecular weight of 455.00 g/mol. Its IUPAC name is 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 133148738 |
| Molecular Formula | C26H31ClN2O3 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[benzyl-[2-(2-chlorophenoxy)acetyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | CC(C(=O)NCCC1=CCCCC1)N(Cc1ccccc1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C26H31ClN2O3/c1-20(26(31)28-17-16-21-10-4-2-5-11-21)29(18-22-12-6-3-7-13-22)25(30)19-32-24-15-9-8-14-23(24)27/h3,6-10,12-15,20H,2,4-5,11,16-19H2,1H3,(H,28,31) |
| InChIKey | PFYPDUVMQDWQRM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|