C22H27ClN2O3 — CID 132661900
2-[[2-(2-chlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-propylpropanamide (PubChem CID 132661900) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-propylpropanamide.
| Compound Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 132661900 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[[2-(2-chlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N(Cc1cccc(C)c1)C(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C22H27ClN2O3/c1-4-12-24-22(27)17(3)25(14-18-9-7-8-16(2)13-18)21(26)15-28-20-11-6-5-10-19(20)23/h5-11,13,17H,4,12,14-15H2,1-3H3,(H,24,27) |
| InChIKey | AEYYUILZEDQFOH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |