C23H28Cl2N2O3 — CID 132717282
N-butyl-2-[[2-(2,4-dichlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]propanamide (PubChem CID 132717282) has the molecular formula C23H28Cl2N2O3 and a molecular weight of 451.39 g/mol. Its IUPAC name is N-butyl-2-[[2-(2,4-dichlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]propanamide.
| Compound Name | N-butyl-2-[[2-(2,4-dichlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 132717282 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | N-butyl-2-[[2-(2,4-dichlorophenoxy)acetyl]-[(3-methylphenyl)methyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(C)c1)C(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-4-5-11-26-23(29)17(3)27(14-18-8-6-7-16(2)12-18)22(28)15-30-21-10-9-19(24)13-20(21)25/h6-10,12-13,17H,4-5,11,14-15H2,1-3H3,(H,26,29) |
| InChIKey | MRBWDXWKRZCHFZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|