C26H36N2O3 — CID 132709997
N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]propanamide (PubChem CID 132709997) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132709997 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(C)c1)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C26H36N2O3/c1-7-8-12-27-26(30)22(6)28(16-23-11-9-10-18(2)14-23)25(29)17-31-24-15-19(3)13-20(4)21(24)5/h9-11,13-15,22H,7-8,12,16-17H2,1-6H3,(H,27,30) |
| InChIKey | WHUHIFNSBFOXSN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|