C32H40N2O3 — CID 133153328
N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 133153328) has the molecular formula C32H40N2O3 and a molecular weight of 500.68 g/mol. Its IUPAC name is N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133153328 |
| Molecular Formula | C32H40N2O3 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-butyl-2-[(3-methylphenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C32H40N2O3/c1-6-7-16-33-32(36)29(20-27-13-9-8-10-14-27)34(21-28-15-11-12-23(2)18-28)31(35)22-37-30-19-24(3)17-25(4)26(30)5/h8-15,17-19,29H,6-7,16,20-22H2,1-5H3,(H,33,36) |
| InChIKey | JGSUYIWKYAQUEM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|