C31H37BrN2O3 — CID 100596348
(2S)-2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100596348) has the molecular formula C31H37BrN2O3 and a molecular weight of 565.55 g/mol. Its IUPAC name is (2S)-2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100596348 |
| Molecular Formula | C31H37BrN2O3 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | (2S)-2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3-methylphenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(C)c1)C(=O)COc1ccc(CC)cc1Br |
| InChI | InChI=1S/C31H37BrN2O3/c1-4-6-17-33-31(36)28(20-25-12-8-7-9-13-25)34(21-26-14-10-11-23(3)18-26)30(35)22-37-29-16-15-24(5-2)19-27(29)32/h7-16,18-19,28H,4-6,17,20-22H2,1-3H3,(H,33,36)/t28-/m0/s1 |
| InChIKey | BDDRFBMFAZMMJZ-NDEPHWFRSA-N |
| XLogP | 6.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|