C30H33BrCl2N2O3 — CID 133207245
2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133207245) has the molecular formula C30H33BrCl2N2O3 and a molecular weight of 620.42 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207245 |
| Molecular Formula | C30H33BrCl2N2O3 |
| Molecular Weight | 620.42 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | 2-[[2-(2-bromo-4-ethylphenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc(CC)cc1Br |
| InChI | InChI=1S/C30H33BrCl2N2O3/c1-3-5-15-34-30(37)27(18-22-9-7-6-8-10-22)35(19-23-11-13-25(32)26(33)17-23)29(36)20-38-28-14-12-21(4-2)16-24(28)31/h6-14,16-17,27H,3-5,15,18-20H2,1-2H3,(H,34,37) |
| InChIKey | RXSITPOOOAQXLE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.42 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|