C28H28BrCl3N2O3 — CID 133207244
2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133207244) has the molecular formula C28H28BrCl3N2O3 and a molecular weight of 626.81 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133207244 |
| Molecular Formula | C28H28BrCl3N2O3 |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 624.03 |
| IUPAC Name | 2-[[2-(2-bromo-4-chlorophenoxy)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C28H28BrCl3N2O3/c1-2-3-13-33-28(36)25(15-19-7-5-4-6-8-19)34(17-20-9-11-23(31)24(32)14-20)27(35)18-37-26-12-10-21(30)16-22(26)29/h4-12,14,16,25H,2-3,13,15,17-18H2,1H3,(H,33,36) |
| InChIKey | WJIGBSGJLQTIOD-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|