C31H37BrN2O3 — CID 100678389
(2S)-2-[(4-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100678389) has the molecular formula C31H37BrN2O3 and a molecular weight of 565.55 g/mol. Its IUPAC name is (2S)-2-[(4-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100678389 |
| Molecular Formula | C31H37BrN2O3 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | (2S)-2-[(4-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C31H37BrN2O3/c1-5-6-16-33-31(36)28(19-25-10-8-7-9-11-25)34(20-26-12-14-27(32)15-13-26)30(35)21-37-29-18-22(2)17-23(3)24(29)4/h7-15,17-18,28H,5-6,16,19-21H2,1-4H3,(H,33,36)/t28-/m0/s1 |
| InChIKey | DJFRFYWNFNVAOG-NDEPHWFRSA-N |
| XLogP | 6.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|