C30H35ClN2O3 — CID 100639386
(2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100639386) has the molecular formula C30H35ClN2O3 and a molecular weight of 507.07 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100639386 |
| Molecular Formula | C30H35ClN2O3 |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2S)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C30H35ClN2O3/c1-4-5-17-32-30(35)27(19-24-9-7-6-8-10-24)33(20-25-13-15-26(31)16-14-25)29(34)21-36-28-18-22(2)11-12-23(28)3/h6-16,18,27H,4-5,17,19-21H2,1-3H3,(H,32,35)/t27-/m0/s1 |
| InChIKey | BCFLVBPZKBDZKG-MHZLTWQESA-N |
| XLogP | 5.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|