C29H33ClN2O3 — CID 133153407
N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133153407) has the molecular formula C29H33ClN2O3 and a molecular weight of 493.05 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133153407 |
| Molecular Formula | C29H33ClN2O3 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-butyl-2-[[2-(4-chlorophenoxy)acetyl]-[(4-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(C)cc1)C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H33ClN2O3/c1-3-4-18-31-29(34)27(19-23-8-6-5-7-9-23)32(20-24-12-10-22(2)11-13-24)28(33)21-35-26-16-14-25(30)15-17-26/h5-17,27H,3-4,18-21H2,1-2H3,(H,31,34) |
| InChIKey | ZHSZGTUNMUNROC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|