C31H37ClN2O3 — CID 100639441
(2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]-3-phenylpropanamide (PubChem CID 100639441) has the molecular formula C31H37ClN2O3 and a molecular weight of 521.10 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100639441 |
| Molecular Formula | C31H37ClN2O3 |
| Molecular Weight | 521.10 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(4-propan-2-ylphenoxy)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C31H37ClN2O3/c1-4-5-19-33-31(36)29(20-24-9-7-6-8-10-24)34(21-25-11-15-27(32)16-12-25)30(35)22-37-28-17-13-26(14-18-28)23(2)3/h6-18,23,29H,4-5,19-22H2,1-3H3,(H,33,36)/t29-/m1/s1 |
| InChIKey | BERUPVKQEUBPPP-GDLZYMKVSA-N |
| XLogP | 6.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.10 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|