C29H32Cl2N2O3 — CID 133231660
N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133231660) has the molecular formula C29H32Cl2N2O3 and a molecular weight of 527.49 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133231660 |
| Molecular Formula | C29H32Cl2N2O3 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-butyl-2-[[2-(4-chloro-3-methylphenoxy)acetyl]-[(4-chlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C29H32Cl2N2O3/c1-3-4-16-32-29(35)27(18-22-8-6-5-7-9-22)33(19-23-10-12-24(30)13-11-23)28(34)20-36-25-14-15-26(31)21(2)17-25/h5-15,17,27H,3-4,16,18-20H2,1-2H3,(H,32,35) |
| InChIKey | BVQBGOGXHOOSSV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|