C29H34N2O3 — CID 132613864
2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenyl-N-propylpropanamide (PubChem CID 132613864) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenyl-N-propylpropanamide.
| Compound Name | 2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 132613864 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 2-[benzyl-[2-(2,5-dimethylphenoxy)acetyl]amino]-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C29H34N2O3/c1-4-17-30-29(33)26(19-24-11-7-5-8-12-24)31(20-25-13-9-6-10-14-25)28(32)21-34-27-18-22(2)15-16-23(27)3/h5-16,18,26H,4,17,19-21H2,1-3H3,(H,30,33) |
| InChIKey | GWCBZWYJABFNDH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |