C25H33BrN2O3 — CID 133151995
2-[(3-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butylpropanamide (PubChem CID 133151995) has the molecular formula C25H33BrN2O3 and a molecular weight of 489.45 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 133151995 |
| Molecular Formula | C25H33BrN2O3 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(2,3,5-trimethylphenoxy)acetyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(Br)c1)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C25H33BrN2O3/c1-6-7-11-27-25(30)20(5)28(15-21-9-8-10-22(26)14-21)24(29)16-31-23-13-17(2)12-18(3)19(23)4/h8-10,12-14,20H,6-7,11,15-16H2,1-5H3,(H,27,30) |
| InChIKey | BFZGDNDBJHZHDO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|