C28H35ClN2O2 — CID 133214561
N-[(4-chlorophenyl)methyl]-N-[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 133214561) has the molecular formula C28H35ClN2O2 and a molecular weight of 467.05 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 133214561 |
| Molecular Formula | C28H35ClN2O2 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-[1-[2-(cyclohexen-1-yl)ethylamino]-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CCCC(=O)N(Cc1ccc(Cl)cc1)C(Cc1ccccc1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C28H35ClN2O2/c1-2-9-27(32)31(21-24-14-16-25(29)17-15-24)26(20-23-12-7-4-8-13-23)28(33)30-19-18-22-10-5-3-6-11-22/h4,7-8,10,12-17,26H,2-3,5-6,9,11,18-21H2,1H3,(H,30,33) |
| InChIKey | DJBICCISHXNHKW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|