C32H35ClN2O2 — CID 133214619
2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide (PubChem CID 133214619) has the molecular formula C32H35ClN2O2 and a molecular weight of 515.10 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214619 |
| Molecular Formula | C32H35ClN2O2 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(2-phenylacetyl)amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
| SMILES | O=C(NCCC1=CCCCC1)C(Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H35ClN2O2/c33-29-18-16-28(17-19-29)24-35(31(36)23-27-14-8-3-9-15-27)30(22-26-12-6-2-7-13-26)32(37)34-21-20-25-10-4-1-5-11-25/h2-3,6-10,12-19,30H,1,4-5,11,20-24H2,(H,34,37) |
| InChIKey | MKYJMTXUDUVLQN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|