C37H45N3O4S — CID 133213849
2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide (PubChem CID 133213849) has the molecular formula C37H45N3O4S and a molecular weight of 627.85 g/mol. Its IUPAC name is 2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide.
| Compound Name | 2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133213849 |
| Molecular Formula | C37H45N3O4S |
| Molecular Weight | 627.85 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | 2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-N-[2-(cyclohexen-1-yl)ethyl]-3-phenylpropanamide |
| SMILES | O=C(NCCC1=CCCCC1)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C37H45N3O4S/c41-36(23-20-31-18-21-34(22-19-31)45(43,44)39-26-10-11-27-39)40(29-33-16-8-3-9-17-33)35(28-32-14-6-2-7-15-32)37(42)38-25-24-30-12-4-1-5-13-30/h2-3,6-9,12,14-19,21-22,35H,1,4-5,10-11,13,20,23-29H2,(H,38,42) |
| InChIKey | NDCDOFXKHQGZTD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.85 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|