C35H45N3O5S — CID 133213871
2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-3-phenyl-N-(3-propan-2-yloxypropyl)propanamide (PubChem CID 133213871) has the molecular formula C35H45N3O5S and a molecular weight of 619.83 g/mol. Its IUPAC name is 2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-3-phenyl-N-(3-propan-2-yloxypropyl)propanamide.
| Compound Name | 2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-3-phenyl-N-(3-propan-2-yloxypropyl)propanamide |
|---|---|
| PubChem CID | 133213871 |
| Molecular Formula | C35H45N3O5S |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | 2-[benzyl-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyl]amino]-3-phenyl-N-(3-propan-2-yloxypropyl)propanamide |
| SMILES | CC(C)OCCCNC(=O)C(Cc1ccccc1)N(Cc1ccccc1)C(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C35H45N3O5S/c1-28(2)43-25-11-22-36-35(40)33(26-30-12-5-3-6-13-30)38(27-31-14-7-4-8-15-31)34(39)21-18-29-16-19-32(20-17-29)44(41,42)37-23-9-10-24-37/h3-8,12-17,19-20,28,33H,9-11,18,21-27H2,1-2H3,(H,36,40) |
| InChIKey | ADRHQUXOAKJJDV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|