C33H40ClN3O5S — CID 133237421
N-[(4-chlorophenyl)methyl]-N-[2-(3-ethoxypropylamino)-2-oxo-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 133237421) has the molecular formula C33H40ClN3O5S and a molecular weight of 626.22 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-[2-(3-ethoxypropylamino)-2-oxo-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-[2-(3-ethoxypropylamino)-2-oxo-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 133237421 |
| Molecular Formula | C33H40ClN3O5S |
| Molecular Weight | 626.22 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-[2-(3-ethoxypropylamino)-2-oxo-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCOCCCNC(=O)C(c1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C33H40ClN3O5S/c1-2-42-24-8-21-35-33(39)32(28-9-4-3-5-10-28)37(25-27-11-16-29(34)17-12-27)31(38)20-15-26-13-18-30(19-14-26)43(40,41)36-22-6-7-23-36/h3-5,9-14,16-19,32H,2,6-8,15,20-25H2,1H3,(H,35,39) |
| InChIKey | NNDRXBPWPVUYKO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.22 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|