C24H32ClN3O5S — CID 133237548
2-[(4-chlorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-ethoxypropyl)-2-phenylacetamide (PubChem CID 133237548) has the molecular formula C24H32ClN3O5S and a molecular weight of 510.06 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-ethoxypropyl)-2-phenylacetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-ethoxypropyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 133237548 |
| Molecular Formula | C24H32ClN3O5S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-[2-[methyl(methylsulfonyl)amino]acetyl]amino]-N-(3-ethoxypropyl)-2-phenylacetamide |
| SMILES | CCOCCCNC(=O)C(c1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(C)S(C)(=O)=O |
| InChI | InChI=1S/C24H32ClN3O5S/c1-4-33-16-8-15-26-24(30)23(20-9-6-5-7-10-20)28(17-19-11-13-21(25)14-12-19)22(29)18-27(2)34(3,31)32/h5-7,9-14,23H,4,8,15-18H2,1-3H3,(H,26,30) |
| InChIKey | OVXQXDJNVXDCBK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|