C27H28Cl2N2O2 — CID 133237738
N-butyl-2-[[2-(4-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-2-phenylacetamide (PubChem CID 133237738) has the molecular formula C27H28Cl2N2O2 and a molecular weight of 483.44 g/mol. Its IUPAC name is N-butyl-2-[[2-(4-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-2-phenylacetamide.
| Compound Name | N-butyl-2-[[2-(4-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 133237738 |
| Molecular Formula | C27H28Cl2N2O2 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-butyl-2-[[2-(4-chlorophenyl)acetyl]-[(4-chlorophenyl)methyl]amino]-2-phenylacetamide |
| SMILES | CCCCNC(=O)C(c1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H28Cl2N2O2/c1-2-3-17-30-27(33)26(22-7-5-4-6-8-22)31(19-21-11-15-24(29)16-12-21)25(32)18-20-9-13-23(28)14-10-20/h4-16,26H,2-3,17-19H2,1H3,(H,30,33) |
| InChIKey | GNTWDHCARCTDDB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|