C31H29ClN2O3 — CID 133237216
2-[benzyl-[2-(4-chlorophenyl)acetyl]amino]-N-[(2-methoxyphenyl)methyl]-2-phenylacetamide (PubChem CID 133237216) has the molecular formula C31H29ClN2O3 and a molecular weight of 513.04 g/mol. Its IUPAC name is 2-[benzyl-[2-(4-chlorophenyl)acetyl]amino]-N-[(2-methoxyphenyl)methyl]-2-phenylacetamide.
| Compound Name | 2-[benzyl-[2-(4-chlorophenyl)acetyl]amino]-N-[(2-methoxyphenyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 133237216 |
| Molecular Formula | C31H29ClN2O3 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2-[benzyl-[2-(4-chlorophenyl)acetyl]amino]-N-[(2-methoxyphenyl)methyl]-2-phenylacetamide |
| SMILES | COc1ccccc1CNC(=O)C(c1ccccc1)N(Cc1ccccc1)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H29ClN2O3/c1-37-28-15-9-8-14-26(28)21-33-31(36)30(25-12-6-3-7-13-25)34(22-24-10-4-2-5-11-24)29(35)20-23-16-18-27(32)19-17-23/h2-19,30H,20-22H2,1H3,(H,33,36) |
| InChIKey | OTNZQBTWFXEVEM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |