C29H34N2O4 — CID 133236926
2-[benzyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-butyl-2-phenylacetamide (PubChem CID 133236926) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 2-[benzyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-butyl-2-phenylacetamide.
| Compound Name | 2-[benzyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-butyl-2-phenylacetamide |
|---|---|
| PubChem CID | 133236926 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-[benzyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]-N-butyl-2-phenylacetamide |
| SMILES | CCCCNC(=O)C(c1ccccc1)N(Cc1ccccc1)C(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H34N2O4/c1-4-5-18-30-29(33)28(24-14-10-7-11-15-24)31(21-22-12-8-6-9-13-22)27(32)20-23-16-17-25(34-2)26(19-23)35-3/h6-17,19,28H,4-5,18,20-21H2,1-3H3,(H,30,33) |
| InChIKey | XUKMGKZOXBPWEI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|