C31H37FN2O5 — CID 133214958
2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-ethoxypropyl)-3-phenylpropanamide (PubChem CID 133214958) has the molecular formula C31H37FN2O5 and a molecular weight of 536.64 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-ethoxypropyl)-3-phenylpropanamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-ethoxypropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214958 |
| Molecular Formula | C31H37FN2O5 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-ethoxypropyl)-3-phenylpropanamide |
| SMILES | CCOCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C31H37FN2O5/c1-4-39-18-8-17-33-31(36)27(19-23-9-6-5-7-10-23)34(22-24-11-14-26(32)15-12-24)30(35)21-25-13-16-28(37-2)29(20-25)38-3/h5-7,9-16,20,27H,4,8,17-19,21-22H2,1-3H3,(H,33,36) |
| InChIKey | SXLHKGBJLZECKW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|