C30H35FN2O5 — CID 133214940
2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide (PubChem CID 133214940) has the molecular formula C30H35FN2O5 and a molecular weight of 522.62 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 133214940 |
| Molecular Formula | C30H35FN2O5 |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-methoxypropyl)-3-phenylpropanamide |
| SMILES | COCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C30H35FN2O5/c1-36-17-7-16-32-30(35)26(18-22-8-5-4-6-9-22)33(21-23-10-13-25(31)14-11-23)29(34)20-24-12-15-27(37-2)28(19-24)38-3/h4-6,8-15,19,26H,7,16-18,20-21H2,1-3H3,(H,32,35) |
| InChIKey | QJWKDSYHEHMASU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|