C29H33FN2O3 — CID 133215163
N-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide (PubChem CID 133215163) has the molecular formula C29H33FN2O3 and a molecular weight of 476.59 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide.
| Compound Name | N-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133215163 |
| Molecular Formula | C29H33FN2O3 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[(4-fluorophenyl)methyl-(2-phenylacetyl)amino]-3-phenylpropanamide |
| SMILES | CCOCCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H33FN2O3/c1-2-35-19-9-18-31-29(34)27(20-23-10-5-3-6-11-23)32(22-25-14-16-26(30)17-15-25)28(33)21-24-12-7-4-8-13-24/h3-8,10-17,27H,2,9,18-22H2,1H3,(H,31,34) |
| InChIKey | BNEKMUYHCMDXNC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|