C32H40N2O6 — CID 133238582
2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 133238582) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 133238582 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)acetyl]-[(4-methoxyphenyl)methyl]amino]-2-phenyl-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | COc1ccc(CN(C(=O)Cc2ccc(OC)c(OC)c2)C(C(=O)NCCCOC(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H40N2O6/c1-23(2)40-19-9-18-33-32(36)31(26-10-7-6-8-11-26)34(22-24-12-15-27(37-3)16-13-24)30(35)21-25-14-17-28(38-4)29(20-25)39-5/h6-8,10-17,20,23,31H,9,18-19,21-22H2,1-5H3,(H,33,36) |
| InChIKey | OGOIESYEXZSYND-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|