C34H43N3O5S — CID 133238523
N-[(4-methoxyphenyl)methyl]-N-[2-oxo-2-(pentylamino)-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide (PubChem CID 133238523) has the molecular formula C34H43N3O5S and a molecular weight of 605.80 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-N-[2-oxo-2-(pentylamino)-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-N-[2-oxo-2-(pentylamino)-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 133238523 |
| Molecular Formula | C34H43N3O5S |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-N-[2-oxo-2-(pentylamino)-1-phenylethyl]-3-(4-pyrrolidin-1-ylsulfonylphenyl)propanamide |
| SMILES | CCCCCNC(=O)C(c1ccccc1)N(Cc1ccc(OC)cc1)C(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C34H43N3O5S/c1-3-4-8-23-35-34(39)33(29-11-6-5-7-12-29)37(26-28-13-18-30(42-2)19-14-28)32(38)22-17-27-15-20-31(21-16-27)43(40,41)36-24-9-10-25-36/h5-7,11-16,18-21,33H,3-4,8-10,17,22-26H2,1-2H3,(H,35,39) |
| InChIKey | XAYYQWJPBWEQML-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|