C17H23BrN2O5 — CID 8880028
[2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate (PubChem CID 8880028) has the molecular formula C17H23BrN2O5 and a molecular weight of 415.28 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8880028 |
| Molecular Formula | C17H23BrN2O5 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate |
| SMILES | COCCNC(=O)COC(=O)[C@@H](NC(=O)c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C17H23BrN2O5/c1-11(2)15(17(23)25-10-14(21)19-8-9-24-3)20-16(22)12-4-6-13(18)7-5-12/h4-7,11,15H,8-10H2,1-3H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | VMWJIVGYORSMNJ-HNNXBMFYSA-N |
| XLogP | 1.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|