C18H25BrN2O4 — CID 8880032
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate (PubChem CID 8880032) has the molecular formula C18H25BrN2O4 and a molecular weight of 413.31 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 8880032 |
| Molecular Formula | C18H25BrN2O4 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] (2S)-2-[(4-bromobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)[C@@H](NC(=O)c1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C18H25BrN2O4/c1-5-12(4)20-15(22)10-25-18(24)16(11(2)3)21-17(23)13-6-8-14(19)9-7-13/h6-9,11-12,16H,5,10H2,1-4H3,(H,20,22)(H,21,23)/t12-,16+/m1/s1 |
| InChIKey | FFAYBDHYJJJMNT-WBMJQRKESA-N |
| XLogP | 2.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |