C25H27NO7S — CID 42938923
(7-methoxy-2-oxochromen-4-yl)methyl 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 42938923) has the molecular formula C25H27NO7S and a molecular weight of 485.56 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 42938923 |
| Molecular Formula | C25H27NO7S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COc1ccc2c(COC(=O)C3CCCN3S(=O)(=O)c3c(C)cc(C)cc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H27NO7S/c1-15-10-16(2)24(17(3)11-15)34(29,30)26-9-5-6-21(26)25(28)32-14-18-12-23(27)33-22-13-19(31-4)7-8-20(18)22/h7-8,10-13,21H,5-6,9,14H2,1-4H3 |
| InChIKey | MWDMZDCYKQHVKI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|