C14H20N2OS2 — CID 8775607
(4-methylsulfanylphenyl)methyl N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate (PubChem CID 8775607) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate.
| Compound Name | (4-methylsulfanylphenyl)methyl N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775607 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate |
| SMILES | CSc1ccc(CS/C(N)=N/C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C14H20N2OS2/c1-18-13-6-4-11(5-7-13)10-19-14(15)16-9-12-3-2-8-17-12/h4-7,12H,2-3,8-10H2,1H3,(H2,15,16)/t12-/m1/s1 |
| InChIKey | BMXDMMZZPMNXFX-GFCCVEGCSA-N |
| XLogP | 3.14 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|