C19H21ClN2OS — CID 8775554
[(S)-(4-chlorophenyl)-phenylmethyl] N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate (PubChem CID 8775554) has the molecular formula C19H21ClN2OS and a molecular weight of 360.91 g/mol. Its IUPAC name is [(S)-(4-chlorophenyl)-phenylmethyl] N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate.
| Compound Name | [(S)-(4-chlorophenyl)-phenylmethyl] N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate |
|---|---|
| PubChem CID | 8775554 |
| Molecular Formula | C19H21ClN2OS |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [(S)-(4-chlorophenyl)-phenylmethyl] N'-[[(2R)-oxolan-2-yl]methyl]carbamimidothioate |
| SMILES | N/C(=N\C[C@H]1CCCO1)S[C@@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2OS/c20-16-10-8-15(9-11-16)18(14-5-2-1-3-6-14)24-19(21)22-13-17-7-4-12-23-17/h1-3,5-6,8-11,17-18H,4,7,12-13H2,(H2,21,22)/t17-,18+/m1/s1 |
| InChIKey | DBHUKDUUGGGTLA-MSOLQXFVSA-N |
| XLogP | 4.66 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|