C26H26ClNO2 — CID 19118860
N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2,2-diphenylacetamide (PubChem CID 19118860) has the molecular formula C26H26ClNO2 and a molecular weight of 419.95 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2,2-diphenylacetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 19118860 |
| Molecular Formula | C26H26ClNO2 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)-2,2-diphenylacetamide |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N(Cc1ccc(Cl)cc1)CC1CCCO1 |
| InChI | InChI=1S/C26H26ClNO2/c27-23-15-13-20(14-16-23)18-28(19-24-12-7-17-30-24)26(29)25(21-8-3-1-4-9-21)22-10-5-2-6-11-22/h1-6,8-11,13-16,24-25H,7,12,17-19H2 |
| InChIKey | DRADEJJUGMBZLK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |