C19H21ClN2S — CID 8775139
[(S)-(4-chlorophenyl)-phenylmethyl] N'-cyclopentylcarbamimidothioate (PubChem CID 8775139) has the molecular formula C19H21ClN2S and a molecular weight of 344.91 g/mol. Its IUPAC name is [(S)-(4-chlorophenyl)-phenylmethyl] N'-cyclopentylcarbamimidothioate.
| Compound Name | [(S)-(4-chlorophenyl)-phenylmethyl] N'-cyclopentylcarbamimidothioate |
|---|---|
| PubChem CID | 8775139 |
| Molecular Formula | C19H21ClN2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | [(S)-(4-chlorophenyl)-phenylmethyl] N'-cyclopentylcarbamimidothioate |
| SMILES | N/C(=N\C1CCCC1)S[C@@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2S/c20-16-12-10-15(11-13-16)18(14-6-2-1-3-7-14)23-19(21)22-17-8-4-5-9-17/h1-3,6-7,10-13,17-18H,4-5,8-9H2,(H2,21,22)/t18-/m0/s1 |
| InChIKey | KDTHMGJZIYPVNM-SFHVURJKSA-N |
| XLogP | 5.42 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|