C22H32ClN3 — CID 101272729
2-(4-chlorophenyl)-N-cyclohexyl-1,2-dipyrrolidin-1-ylethanimine (PubChem CID 101272729) has the molecular formula C22H32ClN3 and a molecular weight of 373.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-cyclohexyl-1,2-dipyrrolidin-1-ylethanimine.
| Compound Name | 2-(4-chlorophenyl)-N-cyclohexyl-1,2-dipyrrolidin-1-ylethanimine |
|---|---|
| PubChem CID | 101272729 |
| Molecular Formula | C22H32ClN3 |
| Molecular Weight | 373.97 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-(4-chlorophenyl)-N-cyclohexyl-1,2-dipyrrolidin-1-ylethanimine |
| SMILES | Clc1ccc(C(/C(=N/C2CCCCC2)N2CCCC2)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H32ClN3/c23-19-12-10-18(11-13-19)21(25-14-4-5-15-25)22(26-16-6-7-17-26)24-20-8-2-1-3-9-20/h10-13,20-21H,1-9,14-17H2/b24-22- |
| InChIKey | GHQZWQJEBUZDOE-GYHWCHFESA-N |
| XLogP | 5.30 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.97 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|