C15H22ClNO2 — CID 129404174
2-[(R)-(4-chlorophenyl)-piperidin-1-ylmethyl]propane-1,3-diol (PubChem CID 129404174) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is 2-[(R)-(4-chlorophenyl)-piperidin-1-ylmethyl]propane-1,3-diol.
| Compound Name | 2-[(R)-(4-chlorophenyl)-piperidin-1-ylmethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 129404174 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[(R)-(4-chlorophenyl)-piperidin-1-ylmethyl]propane-1,3-diol |
| SMILES | OCC(CO)[C@H](c1ccc(Cl)cc1)N1CCCCC1 |
| InChI | InChI=1S/C15H22ClNO2/c16-14-6-4-12(5-7-14)15(13(10-18)11-19)17-8-2-1-3-9-17/h4-7,13,15,18-19H,1-3,8-11H2/t15-/m0/s1 |
| InChIKey | AURFMXOHIVVRBI-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |